C35H41NO6S — CID 126082584
[2-ethoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-6-prop-2-enylphenyl] benzenesulfonate (PubChem CID 126082584) has the molecular formula C35H41NO6S and a molecular weight of 603.78 g/mol. Its IUPAC name is [2-ethoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-6-prop-2-enylphenyl] benzenesulfonate.
| Compound Name | [2-ethoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-6-prop-2-enylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126082584 |
| Molecular Formula | C35H41NO6S |
| Molecular Weight | 603.78 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | [2-ethoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-6-prop-2-enylphenyl] benzenesulfonate |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(C)C3=C2C(=O)CC(C)(C)C3)cc(OCC)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H41NO6S/c1-8-13-22-16-23(17-29(41-9-2)33(22)42-43(39,40)24-14-11-10-12-15-24)30-31-25(18-34(3,4)20-27(31)37)36(7)26-19-35(5,6)21-28(38)32(26)30/h8,10-12,14-17,30H,1,9,13,18-21H2,2-7H3 |
| InChIKey | ZVDCHGOEZKXZKJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.78 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|