C34H38BrNO4 — CID 126076639
9-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 126076639) has the molecular formula C34H38BrNO4 and a molecular weight of 604.59 g/mol. Its IUPAC name is 9-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 126076639 |
| Molecular Formula | C34H38BrNO4 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | 9-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc(OC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C34H38BrNO4/c1-7-8-21-13-22(14-28(39-6)32(21)40-19-20-9-11-23(35)12-10-20)29-30-24(15-33(2,3)17-26(30)37)36-25-16-34(4,5)18-27(38)31(25)29/h7,9-14,29,36H,1,8,15-19H2,2-6H3 |
| InChIKey | NRVQPYHVEDXDMI-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|