C30H30Br2ClNO3 — CID 126060284
9-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 126060284) has the molecular formula C30H30Br2ClNO3 and a molecular weight of 647.84 g/mol. Its IUPAC name is 9-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 126060284 |
| Molecular Formula | C30H30Br2ClNO3 |
| Molecular Weight | 647.84 g/mol |
| Exact Mass | 645.03 |
| IUPAC Name | 9-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)CC(C)(C)C1)C2c1cc(Br)c(OCc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C30H30Br2ClNO3/c1-29(2)11-21-26(23(35)13-29)25(27-22(34-21)12-30(3,4)14-24(27)36)17-9-19(31)28(20(32)10-17)37-15-16-5-7-18(33)8-6-16/h5-10,25,34H,11-15H2,1-4H3 |
| InChIKey | DEJQMHWYFLBNEG-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.84 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |