C23H25Br2NO3 — CID 23775565
9-(3,5-dibromo-4-hydroxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 23775565) has the molecular formula C23H25Br2NO3 and a molecular weight of 523.27 g/mol. Its IUPAC name is 9-(3,5-dibromo-4-hydroxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-(3,5-dibromo-4-hydroxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 23775565 |
| Molecular Formula | C23H25Br2NO3 |
| Molecular Weight | 523.27 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | 9-(3,5-dibromo-4-hydroxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)CC(C)(C)C1)C2c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C23H25Br2NO3/c1-22(2)7-14-19(16(27)9-22)18(11-5-12(24)21(29)13(25)6-11)20-15(26-14)8-23(3,4)10-17(20)28/h5-6,18,26,29H,7-10H2,1-4H3 |
| InChIKey | JMISUWAZHVXWNQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.27 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |