C20H20BrN3O5 — CID 1188229
(5S)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 1188229) has the molecular formula C20H20BrN3O5 and a molecular weight of 462.30 g/mol. Its IUPAC name is (5S)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | (5S)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 1188229 |
| Molecular Formula | C20H20BrN3O5 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (5S)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | COc1cc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3[nH]c(=O)[nH]c(=O)c32)cc(Br)c1O |
| InChI | InChI=1S/C20H20BrN3O5/c1-20(2)6-10-14(11(25)7-20)13(8-4-9(21)16(26)12(5-8)29-3)15-17(22-10)23-19(28)24-18(15)27/h4-5,13,26H,6-7H2,1-3H3,(H3,22,23,24,27,28)/t13-/m0/s1 |
| InChIKey | KDRRPXZCECEJPS-ZDUSSCGKSA-N |
| XLogP | 2.74 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |