C21H23N3O6 — CID 6484442
5-(4-hydroxy-3,5-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 6484442) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 5-(4-hydroxy-3,5-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 5-(4-hydroxy-3,5-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 6484442 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 5-(4-hydroxy-3,5-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3[nH]c(=O)[nH]c(=O)c32)cc(OC)c1O |
| InChI | InChI=1S/C21H23N3O6/c1-21(2)7-10-15(11(25)8-21)14(16-18(22-10)23-20(28)24-19(16)27)9-5-12(29-3)17(26)13(6-9)30-4/h5-6,14,26H,7-8H2,1-4H3,(H3,22,23,24,27,28) |
| InChIKey | KRZCZXMTWADUDL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |