C19H20N4O6 — CID 42548919
(4S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 42548919) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is (4S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | (4S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 42548919 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (4S)-4-(4-hydroxy-3-methoxy-5-nitrophenyl)-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | COc1cc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3[nH][nH]c(=O)c32)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H20N4O6/c1-19(2)6-9-14(11(24)7-19)13(15-17(20-9)21-22-18(15)26)8-4-10(23(27)28)16(25)12(5-8)29-3/h4-5,13,25H,6-7H2,1-3H3,(H3,20,21,22,26)/t13-/m0/s1 |
| InChIKey | NEWNVWSAHCOGOL-ZDUSSCGKSA-N |
| XLogP | 2.53 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|