C17H18N6O5 — CID 135913255
(9S)-9-(4-hydroxy-3-methoxy-5-nitrophenyl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one (PubChem CID 135913255) has the molecular formula C17H18N6O5 and a molecular weight of 386.37 g/mol. Its IUPAC name is (9S)-9-(4-hydroxy-3-methoxy-5-nitrophenyl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9S)-9-(4-hydroxy-3-methoxy-5-nitrophenyl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135913255 |
| Molecular Formula | C17H18N6O5 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (9S)-9-(4-hydroxy-3-methoxy-5-nitrophenyl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nnnn32)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H18N6O5/c1-17(2)6-9-13(11(24)7-17)14(22-16(18-9)19-20-21-22)8-4-10(23(26)27)15(25)12(5-8)28-3/h4-5,14,25H,6-7H2,1-3H3,(H,18,19,21)/t14-/m0/s1 |
| InChIKey | OICUDOKGSOYICX-AWEZNQCLSA-N |
| XLogP | 1.95 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|