C18H21N5O3 — CID 136773562
(9R)-9-(2,3-dimethoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one (PubChem CID 136773562) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is (9R)-9-(2,3-dimethoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(2,3-dimethoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136773562 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (9R)-9-(2,3-dimethoxyphenyl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cccc([C@@H]2C3=C(CC(C)(C)CC3=O)Nc3nnnn32)c1OC |
| InChI | InChI=1S/C18H21N5O3/c1-18(2)8-11-14(12(24)9-18)15(23-17(19-11)20-21-22-23)10-6-5-7-13(25-3)16(10)26-4/h5-7,15H,8-9H2,1-4H3,(H,19,20,22)/t15-/m1/s1 |
| InChIKey | PBYKELMZDJEGQM-OAHLLOKOSA-N |
| XLogP | 2.35 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |