C26H27FN4O3S — CID 136806961
(9S)-9-(2,3-dimethoxyphenyl)-2-[(3-fluorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136806961) has the molecular formula C26H27FN4O3S and a molecular weight of 494.59 g/mol. Its IUPAC name is (9S)-9-(2,3-dimethoxyphenyl)-2-[(3-fluorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9S)-9-(2,3-dimethoxyphenyl)-2-[(3-fluorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136806961 |
| Molecular Formula | C26H27FN4O3S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | (9S)-9-(2,3-dimethoxyphenyl)-2-[(3-fluorophenyl)methylsulfanyl]-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4cccc(F)c4)nn32)c1OC |
| InChI | InChI=1S/C26H27FN4O3S/c1-26(2)12-18-21(19(32)13-26)22(17-9-6-10-20(33-3)23(17)34-4)31-24(28-18)29-25(30-31)35-14-15-7-5-8-16(27)11-15/h5-11,22H,12-14H2,1-4H3,(H,28,29,30)/t22-/m0/s1 |
| InChIKey | JKBNGEATFPAEHU-QFIPXVFZSA-N |
| XLogP | 5.38 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |