C26H31Br2NO3 — CID 126050526
9-(3,5-dibromo-4-propoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 126050526) has the molecular formula C26H31Br2NO3 and a molecular weight of 565.35 g/mol. Its IUPAC name is 9-(3,5-dibromo-4-propoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-(3,5-dibromo-4-propoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 126050526 |
| Molecular Formula | C26H31Br2NO3 |
| Molecular Weight | 565.35 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | 9-(3,5-dibromo-4-propoxyphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | CCCOc1c(Br)cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc1Br |
| InChI | InChI=1S/C26H31Br2NO3/c1-6-7-32-24-15(27)8-14(9-16(24)28)21-22-17(10-25(2,3)12-19(22)30)29-18-11-26(4,5)13-20(31)23(18)21/h8-9,21,29H,6-7,10-13H2,1-5H3 |
| InChIKey | AVNQAALVEAJOFL-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.35 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |