C32H36BrNO6S — CID 126077617
[2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 126077617) has the molecular formula C32H36BrNO6S and a molecular weight of 642.61 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126077617 |
| Molecular Formula | C32H36BrNO6S |
| Molecular Weight | 642.61 g/mol |
| Exact Mass | 641.14 |
| IUPAC Name | [2-bromo-6-ethoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc(Br)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H36BrNO6S/c1-7-39-26-13-19(12-21(33)30(26)40-41(37,38)20-10-8-18(2)9-11-20)27-28-22(14-31(3,4)16-24(28)35)34-23-15-32(5,6)17-25(36)29(23)27/h8-13,27,34H,7,14-17H2,1-6H3 |
| InChIKey | QCVIMPZFVHFIQG-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.61 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|