C28H28INO6S — CID 3626096
[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-ethoxy-6-iodophenyl] 4-methylbenzenesulfonate (PubChem CID 3626096) has the molecular formula C28H28INO6S and a molecular weight of 633.50 g/mol. Its IUPAC name is [4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-ethoxy-6-iodophenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-ethoxy-6-iodophenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3626096 |
| Molecular Formula | C28H28INO6S |
| Molecular Weight | 633.50 g/mol |
| Exact Mass | 633.07 |
| IUPAC Name | [4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-ethoxy-6-iodophenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)NC3=C2C(=O)CCC3)cc(I)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H28INO6S/c1-3-35-24-15-17(14-19(29)28(24)36-37(33,34)18-12-10-16(2)11-13-18)25-26-20(6-4-8-22(26)31)30-21-7-5-9-23(32)27(21)25/h10-15,25,30H,3-9H2,1-2H3 |
| InChIKey | AGPRCQWHFGWEPX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|