C27H25ClINO6S — CID 126078427
[2-iodo-6-methoxy-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate (PubChem CID 126078427) has the molecular formula C27H25ClINO6S and a molecular weight of 653.92 g/mol. Its IUPAC name is [2-iodo-6-methoxy-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-iodo-6-methoxy-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126078427 |
| Molecular Formula | C27H25ClINO6S |
| Molecular Weight | 653.92 g/mol |
| Exact Mass | 653.01 |
| IUPAC Name | [2-iodo-6-methoxy-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(C2C3=C(CCCC3=O)N(C)C3=C2C(=O)CCC3)cc(I)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H25ClINO6S/c1-30-19-5-3-7-21(31)25(19)24(26-20(30)6-4-8-22(26)32)15-13-18(29)27(23(14-15)35-2)36-37(33,34)17-11-9-16(28)10-12-17/h9-14,24H,3-8H2,1-2H3 |
| InChIKey | UMHMYROKRIEHSD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.92 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|