C26H23Cl2NO5S — CID 126081900
[2,6-dichloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] benzenesulfonate (PubChem CID 126081900) has the molecular formula C26H23Cl2NO5S and a molecular weight of 532.45 g/mol. Its IUPAC name is [2,6-dichloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] benzenesulfonate.
| Compound Name | [2,6-dichloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126081900 |
| Molecular Formula | C26H23Cl2NO5S |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | [2,6-dichloro-4-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] benzenesulfonate |
| SMILES | CN1C2=C(C(=O)CCC2)C(c2cc(Cl)c(OS(=O)(=O)c3ccccc3)c(Cl)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C26H23Cl2NO5S/c1-29-19-9-5-11-21(30)24(19)23(25-20(29)10-6-12-22(25)31)15-13-17(27)26(18(28)14-15)34-35(32,33)16-7-3-2-4-8-16/h2-4,7-8,13-14,23H,5-6,9-12H2,1H3 |
| InChIKey | WSBSZYSULJIRRC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|