C28H25Br2NO7S — CID 126075856
3-[9-[4-(benzenesulfonyloxy)-3,5-dibromophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126075856) has the molecular formula C28H25Br2NO7S and a molecular weight of 679.38 g/mol. Its IUPAC name is 3-[9-[4-(benzenesulfonyloxy)-3,5-dibromophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[4-(benzenesulfonyloxy)-3,5-dibromophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126075856 |
| Molecular Formula | C28H25Br2NO7S |
| Molecular Weight | 679.38 g/mol |
| Exact Mass | 676.97 |
| IUPAC Name | 3-[9-[4-(benzenesulfonyloxy)-3,5-dibromophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | O=C(O)CCN1C2=C(C(=O)CCC2)C(c2cc(Br)c(OS(=O)(=O)c3ccccc3)c(Br)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C28H25Br2NO7S/c29-18-14-16(15-19(30)28(18)38-39(36,37)17-6-2-1-3-7-17)25-26-20(8-4-10-22(26)32)31(13-12-24(34)35)21-9-5-11-23(33)27(21)25/h1-3,6-7,14-15,25H,4-5,8-13H2,(H,34,35) |
| InChIKey | DBHNVUTYSKXHDF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|