C28H24BrN3O9 — CID 126084140
3-[9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126084140) has the molecular formula C28H24BrN3O9 and a molecular weight of 626.42 g/mol. Its IUPAC name is 3-[9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126084140 |
| Molecular Formula | C28H24BrN3O9 |
| Molecular Weight | 626.42 g/mol |
| Exact Mass | 625.07 |
| IUPAC Name | 3-[9-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | O=C(O)CCN1C2=C(C(=O)CCC2)C(c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Br)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C28H24BrN3O9/c29-17-13-15(7-9-23(17)41-24-10-8-16(31(37)38)14-20(24)32(39)40)26-27-18(3-1-5-21(27)33)30(12-11-25(35)36)19-4-2-6-22(34)28(19)26/h7-10,13-14,26H,1-6,11-12H2,(H,35,36) |
| InChIKey | AAOYFBVLHJKCQO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|