C29H28BrN3O8 — CID 126083562
9-[3-bromo-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126083562) has the molecular formula C29H28BrN3O8 and a molecular weight of 626.46 g/mol. Its IUPAC name is 9-[3-bromo-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-bromo-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126083562 |
| Molecular Formula | C29H28BrN3O8 |
| Molecular Weight | 626.46 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | 9-[3-bromo-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N(CC)C3=C2C(=O)CCC3)cc(Br)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H28BrN3O8/c1-3-31-19-7-5-9-22(34)27(19)26(28-20(31)8-6-10-23(28)35)16-13-18(30)29(25(14-16)40-4-2)41-24-12-11-17(32(36)37)15-21(24)33(38)39/h11-15,26H,3-10H2,1-2H3 |
| InChIKey | CUAGFMLLHLMTQL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|