C32H31N3O10 — CID 126097744
3-[9-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126097744) has the molecular formula C32H31N3O10 and a molecular weight of 617.61 g/mol. Its IUPAC name is 3-[9-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126097744 |
| Molecular Formula | C32H31N3O10 |
| Molecular Weight | 617.61 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | 3-[9-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CCC(=O)O)C3=C2C(=O)CCC3)cc(OC)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H31N3O10/c1-3-6-18-15-19(16-27(44-2)32(18)45-26-12-11-20(34(40)41)17-23(26)35(42)43)29-30-21(7-4-9-24(30)36)33(14-13-28(38)39)22-8-5-10-25(37)31(22)29/h3,11-12,15-17,29H,1,4-10,13-14H2,2H3,(H,38,39) |
| InChIKey | QDFDTSAZZPYIMH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 179.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|