C30H28ClN3O10 — CID 126097110
3-[9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126097110) has the molecular formula C30H28ClN3O10 and a molecular weight of 626.02 g/mol. Its IUPAC name is 3-[9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126097110 |
| Molecular Formula | C30H28ClN3O10 |
| Molecular Weight | 626.02 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | 3-[9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N(CCC(=O)O)C3=C2C(=O)CCC3)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H28ClN3O10/c1-2-43-25-14-16(13-18(31)30(25)44-24-10-9-17(33(39)40)15-21(24)34(41)42)27-28-19(5-3-7-22(28)35)32(12-11-26(37)38)20-6-4-8-23(36)29(20)27/h9-10,13-15,27H,2-8,11-12H2,1H3,(H,37,38) |
| InChIKey | PZDMXVOSMLEICL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 179.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.02 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|