C28H24BrF3N2O5 — CID 126097457
9-[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126097457) has the molecular formula C28H24BrF3N2O5 and a molecular weight of 605.41 g/mol. Its IUPAC name is 9-[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126097457 |
| Molecular Formula | C28H24BrF3N2O5 |
| Molecular Weight | 605.41 g/mol |
| Exact Mass | 604.08 |
| IUPAC Name | 9-[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(Br)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C28H24BrF3N2O5/c1-2-33-18-5-3-7-21(35)26(18)25(27-19(33)6-4-8-22(27)36)15-9-11-23(17(29)13-15)39-24-12-10-16(28(30,31)32)14-20(24)34(37)38/h9-14,25H,2-8H2,1H3 |
| InChIKey | PEQCTIBKBXRNJD-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.41 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|