C28H24ClF3N2O5 — CID 126089259
9-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126089259) has the molecular formula C28H24ClF3N2O5 and a molecular weight of 560.96 g/mol. Its IUPAC name is 9-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126089259 |
| Molecular Formula | C28H24ClF3N2O5 |
| Molecular Weight | 560.96 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | 9-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-ethyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(Cl)ccc2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])C2=C1CCCC2=O |
| InChI | InChI=1S/C28H24ClF3N2O5/c1-2-33-18-5-3-7-21(35)26(18)25(27-19(33)6-4-8-22(27)36)17-14-16(29)10-12-23(17)39-24-11-9-15(28(30,31)32)13-20(24)34(37)38/h9-14,25H,2-8H2,1H3 |
| InChIKey | UDDIVNPFSWZLEP-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.96 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|