C32H29Cl2F3N2O7 — CID 126099369
2-[9-[3,5-dichloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126099369) has the molecular formula C32H29Cl2F3N2O7 and a molecular weight of 681.49 g/mol. Its IUPAC name is 2-[9-[3,5-dichloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[3,5-dichloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126099369 |
| Molecular Formula | C32H29Cl2F3N2O7 |
| Molecular Weight | 681.49 g/mol |
| Exact Mass | 680.13 |
| IUPAC Name | 2-[9-[3,5-dichloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CC(=O)O)C1=C(C(=O)CC(C)(C)C1)C2c1cc(Cl)cc(Cl)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H29Cl2F3N2O7/c1-30(2)10-20-27(22(40)12-30)26(28-21(38(20)14-25(42)43)11-31(3,4)13-23(28)41)17-8-16(33)9-18(34)29(17)46-24-6-5-15(32(35,36)37)7-19(24)39(44)45/h5-9,26H,10-14H2,1-4H3,(H,42,43) |
| InChIKey | XMICDQIJQHOLKS-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.49 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|