C27H26ClNO5S — CID 126074292
[4-chloro-2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] benzenesulfonate (PubChem CID 126074292) has the molecular formula C27H26ClNO5S and a molecular weight of 512.03 g/mol. Its IUPAC name is [4-chloro-2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] benzenesulfonate.
| Compound Name | [4-chloro-2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126074292 |
| Molecular Formula | C27H26ClNO5S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | [4-chloro-2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] benzenesulfonate |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(Cl)ccc2OS(=O)(=O)c2ccccc2)C2=C1CCCC2=O |
| InChI | InChI=1S/C27H26ClNO5S/c1-2-29-20-10-6-12-22(30)26(20)25(27-21(29)11-7-13-23(27)31)19-16-17(28)14-15-24(19)34-35(32,33)18-8-4-3-5-9-18/h3-5,8-9,14-16,25H,2,6-7,10-13H2,1H3 |
| InChIKey | RPYSZYZHWKRODV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|