C28H28ClNO5S — CID 126078087
[4-chloro-2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 126078087) has the molecular formula C28H28ClNO5S and a molecular weight of 526.05 g/mol. Its IUPAC name is [4-chloro-2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-chloro-2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126078087 |
| Molecular Formula | C28H28ClNO5S |
| Molecular Weight | 526.05 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | [4-chloro-2-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2cc(Cl)ccc2OS(=O)(=O)c2ccc(C)cc2)C2=C1CCCC2=O |
| InChI | InChI=1S/C28H28ClNO5S/c1-3-30-21-6-4-8-23(31)27(21)26(28-22(30)7-5-9-24(28)32)20-16-18(29)12-15-25(20)35-36(33,34)19-13-10-17(2)11-14-19/h10-16,26H,3-9H2,1-2H3 |
| InChIKey | PQNZTCDLBYTBJH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.05 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|