C27H25Br2NO5S — CID 126054073
[2,4-dibromo-6-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 126054073) has the molecular formula C27H25Br2NO5S and a molecular weight of 635.37 g/mol. Its IUPAC name is [2,4-dibromo-6-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,4-dibromo-6-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126054073 |
| Molecular Formula | C27H25Br2NO5S |
| Molecular Weight | 635.37 g/mol |
| Exact Mass | 632.98 |
| IUPAC Name | [2,4-dibromo-6-(10-methyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(Br)cc(Br)cc2C2C3=C(CCCC3=O)N(C)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C27H25Br2NO5S/c1-15-9-11-17(12-10-15)36(33,34)35-27-18(13-16(28)14-19(27)29)24-25-20(5-3-7-22(25)31)30(2)21-6-4-8-23(32)26(21)24/h9-14,24H,3-8H2,1-2H3 |
| InChIKey | PHGDLVVZYRAISZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.37 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|