C33H35Br2NO7S — CID 126073678
3-[9-[3,5-dibromo-2-(4-methylphenyl)sulfonyloxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126073678) has the molecular formula C33H35Br2NO7S and a molecular weight of 749.52 g/mol. Its IUPAC name is 3-[9-[3,5-dibromo-2-(4-methylphenyl)sulfonyloxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3,5-dibromo-2-(4-methylphenyl)sulfonyloxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126073678 |
| Molecular Formula | C33H35Br2NO7S |
| Molecular Weight | 749.52 g/mol |
| Exact Mass | 747.05 |
| IUPAC Name | 3-[9-[3,5-dibromo-2-(4-methylphenyl)sulfonyloxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(Br)cc(Br)cc2C2C3=C(CC(C)(C)CC3=O)N(CCC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C33H35Br2NO7S/c1-18-6-8-20(9-7-18)44(41,42)43-31-21(12-19(34)13-22(31)35)28-29-23(14-32(2,3)16-25(29)37)36(11-10-27(39)40)24-15-33(4,5)17-26(38)30(24)28/h6-9,12-13,28H,10-11,14-17H2,1-5H3,(H,39,40) |
| InChIKey | QBQJLARSWHOXBS-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.52 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|