C33H37Br2NO6S — CID 126080464
[2,4-dibromo-6-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126080464) has the molecular formula C33H37Br2NO6S and a molecular weight of 735.54 g/mol. Its IUPAC name is [2,4-dibromo-6-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,4-dibromo-6-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126080464 |
| Molecular Formula | C33H37Br2NO6S |
| Molecular Weight | 735.54 g/mol |
| Exact Mass | 733.07 |
| IUPAC Name | [2,4-dibromo-6-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Br)cc(Br)c2OS(=O)(=O)c2ccc(C)cc2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C33H37Br2NO6S/c1-19-7-9-21(10-8-19)43(39,40)42-31-22(13-20(34)14-23(31)35)28-29-24(15-32(2,3)17-26(29)37)36(11-12-41-6)25-16-33(4,5)18-27(38)30(25)28/h7-10,13-14,28H,11-12,15-18H2,1-6H3 |
| InChIKey | XUVYXOLJXDSENV-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.54 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|