C26H29Br2NO5 — CID 126054051
2-[9-(3,5-dibromo-2-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126054051) has the molecular formula C26H29Br2NO5 and a molecular weight of 595.33 g/mol. Its IUPAC name is 2-[9-(3,5-dibromo-2-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-(3,5-dibromo-2-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126054051 |
| Molecular Formula | C26H29Br2NO5 |
| Molecular Weight | 595.33 g/mol |
| Exact Mass | 593.04 |
| IUPAC Name | 2-[9-(3,5-dibromo-2-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]acetic acid |
| SMILES | COc1c(Br)cc(Br)cc1C1C2=C(CC(C)(C)CC2=O)N(CC(=O)O)C2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H29Br2NO5/c1-25(2)8-16-22(18(30)10-25)21(14-6-13(27)7-15(28)24(14)34-5)23-17(29(16)12-20(32)33)9-26(3,4)11-19(23)31/h6-7,21H,8-12H2,1-5H3,(H,32,33) |
| InChIKey | OZAVPSTUKDEDEK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.33 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |