C35H40Br2N2O4 — CID 126266187
2-[2,4-dibromo-6-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126266187) has the molecular formula C35H40Br2N2O4 and a molecular weight of 712.52 g/mol. Its IUPAC name is 2-[2,4-dibromo-6-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2,4-dibromo-6-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126266187 |
| Molecular Formula | C35H40Br2N2O4 |
| Molecular Weight | 712.52 g/mol |
| Exact Mass | 710.14 |
| IUPAC Name | 2-[2,4-dibromo-6-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Br)cc(Br)c2OCC(=O)Nc2ccc(C)cc2C)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C35H40Br2N2O4/c1-8-39-25-14-34(4,5)16-27(40)31(25)30(32-26(39)15-35(6,7)17-28(32)41)22-12-21(36)13-23(37)33(22)43-18-29(42)38-24-10-9-19(2)11-20(24)3/h9-13,30H,8,14-18H2,1-7H3,(H,38,42) |
| InChIKey | JICOWIFZDOVBNQ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.52 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |