C30H31Br2NO3 — CID 126053807
10-benzyl-9-(3,5-dibromo-2-hydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126053807) has the molecular formula C30H31Br2NO3 and a molecular weight of 613.39 g/mol. Its IUPAC name is 10-benzyl-9-(3,5-dibromo-2-hydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-benzyl-9-(3,5-dibromo-2-hydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126053807 |
| Molecular Formula | C30H31Br2NO3 |
| Molecular Weight | 613.39 g/mol |
| Exact Mass | 611.07 |
| IUPAC Name | 10-benzyl-9-(3,5-dibromo-2-hydroxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(Cc1ccccc1)C1=C(C(=O)CC(C)(C)C1)C2c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C30H31Br2NO3/c1-29(2)12-21-26(23(34)14-29)25(19-10-18(31)11-20(32)28(19)36)27-22(13-30(3,4)15-24(27)35)33(21)16-17-8-6-5-7-9-17/h5-11,25,36H,12-16H2,1-4H3 |
| InChIKey | UFYFCOYIAMVYJF-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.39 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |