C31H34BrNO3 — CID 126046922
9-(5-bromo-2-hydroxyphenyl)-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126046922) has the molecular formula C31H34BrNO3 and a molecular weight of 548.52 g/mol. Its IUPAC name is 9-(5-bromo-2-hydroxyphenyl)-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(5-bromo-2-hydroxyphenyl)-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126046922 |
| Molecular Formula | C31H34BrNO3 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 9-(5-bromo-2-hydroxyphenyl)-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CCc1ccccc1)C1=C(C(=O)CC(C)(C)C1)C2c1cc(Br)ccc1O |
| InChI | InChI=1S/C31H34BrNO3/c1-30(2)15-22-28(25(35)17-30)27(21-14-20(32)10-11-24(21)34)29-23(16-31(3,4)18-26(29)36)33(22)13-12-19-8-6-5-7-9-19/h5-11,14,27,34H,12-13,15-18H2,1-4H3 |
| InChIKey | YJSQINXMZNWTHM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |