C40H44N2O4 — CID 126263889
N-(3-methylphenyl)-2-[2-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetamide (PubChem CID 126263889) has the molecular formula C40H44N2O4 and a molecular weight of 616.80 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[2-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[2-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126263889 |
| Molecular Formula | C40H44N2O4 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | N-(3-methylphenyl)-2-[2-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccccc2C2C3=C(CC(C)(C)CC3=O)N(CCc3ccccc3)C3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C40H44N2O4/c1-26-12-11-15-28(20-26)41-35(45)25-46-34-17-10-9-16-29(34)36-37-30(21-39(2,3)23-32(37)43)42(19-18-27-13-7-6-8-14-27)31-22-40(4,5)24-33(44)38(31)36/h6-17,20,36H,18-19,21-25H2,1-5H3,(H,41,45) |
| InChIKey | PVJKONLEIBPQND-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |