C41H46N2O4 — CID 126275518
N-(3,4-dimethylphenyl)-2-[4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetamide (PubChem CID 126275518) has the molecular formula C41H46N2O4 and a molecular weight of 630.83 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126275518 |
| Molecular Formula | C41H46N2O4 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[4-[3,3,6,6-tetramethyl-1,8-dioxo-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C3C4=C(CC(C)(C)CC4=O)N(CCc4ccccc4)C4=C3C(=O)CC(C)(C)C4)cc2)cc1C |
| InChI | InChI=1S/C41H46N2O4/c1-26-12-15-30(20-27(26)2)42-36(46)25-47-31-16-13-29(14-17-31)37-38-32(21-40(3,4)23-34(38)44)43(19-18-28-10-8-7-9-11-28)33-22-41(5,6)24-35(45)39(33)37/h7-17,20,37H,18-19,21-25H2,1-6H3,(H,42,46) |
| InChIKey | HRHKJCSLIQUNFX-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |