C29H38BrNO3 — CID 22333836
9-(5-bromo-2-methoxyphenyl)-3,3,6,6-tetramethyl-10-pentyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 22333836) has the molecular formula C29H38BrNO3 and a molecular weight of 528.53 g/mol. Its IUPAC name is 9-(5-bromo-2-methoxyphenyl)-3,3,6,6-tetramethyl-10-pentyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(5-bromo-2-methoxyphenyl)-3,3,6,6-tetramethyl-10-pentyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 22333836 |
| Molecular Formula | C29H38BrNO3 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 9-(5-bromo-2-methoxyphenyl)-3,3,6,6-tetramethyl-10-pentyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCCCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Br)ccc2OC)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C29H38BrNO3/c1-7-8-9-12-31-20-14-28(2,3)16-22(32)26(20)25(19-13-18(30)10-11-24(19)34-6)27-21(31)15-29(4,5)17-23(27)33/h10-11,13,25H,7-9,12,14-17H2,1-6H3 |
| InChIKey | FXDDZZFJIZZKCX-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|