C29H39NO2 — CID 22333792
3,3,6,6-tetramethyl-9-(4-methylphenyl)-10-pentyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 22333792) has the molecular formula C29H39NO2 and a molecular weight of 433.64 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-(4-methylphenyl)-10-pentyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-(4-methylphenyl)-10-pentyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 22333792 |
| Molecular Formula | C29H39NO2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-(4-methylphenyl)-10-pentyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCCCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(C)cc2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C29H39NO2/c1-7-8-9-14-30-21-15-28(3,4)17-23(31)26(21)25(20-12-10-19(2)11-13-20)27-22(30)16-29(5,6)18-24(27)32/h10-13,25H,7-9,14-18H2,1-6H3 |
| InChIKey | XYUPYRRVVTWALL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|