C32H35NO4 — CID 15993811
10-(1,3-benzodioxol-5-ylmethyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 15993811) has the molecular formula C32H35NO4 and a molecular weight of 497.64 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-ylmethyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(1,3-benzodioxol-5-ylmethyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 15993811 |
| Molecular Formula | C32H35NO4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 10-(1,3-benzodioxol-5-ylmethyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)N(Cc3ccc4c(c3)OCO4)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C32H35NO4/c1-19-6-9-21(10-7-19)28-29-22(13-31(2,3)15-24(29)34)33(23-14-32(4,5)16-25(35)30(23)28)17-20-8-11-26-27(12-20)37-18-36-26/h6-12,28H,13-18H2,1-5H3 |
| InChIKey | QMMGLHWQUMQFKW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |