C32H37NO2 — CID 22333794
10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 22333794) has the molecular formula C32H37NO2 and a molecular weight of 467.65 g/mol. Its IUPAC name is 10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 22333794 |
| Molecular Formula | C32H37NO2 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)N(c3ccc(C)c(C)c3)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C32H37NO2/c1-19-8-11-22(12-9-19)28-29-24(15-31(4,5)17-26(29)34)33(23-13-10-20(2)21(3)14-23)25-16-32(6,7)18-27(35)30(25)28/h8-14,28H,15-18H2,1-7H3 |
| InChIKey | ZETNUVRDLMBPQM-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |