C32H34ClNO5 — CID 15993207
methyl 4-[10-(3-chloro-4-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate (PubChem CID 15993207) has the molecular formula C32H34ClNO5 and a molecular weight of 548.08 g/mol. Its IUPAC name is methyl 4-[10-(3-chloro-4-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate.
| Compound Name | methyl 4-[10-(3-chloro-4-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate |
|---|---|
| PubChem CID | 15993207 |
| Molecular Formula | C32H34ClNO5 |
| Molecular Weight | 548.08 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | methyl 4-[10-(3-chloro-4-methoxyphenyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C3=C(CC(C)(C)CC3=O)N(c3ccc(OC)c(Cl)c3)C3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C32H34ClNO5/c1-31(2)14-22-28(24(35)16-31)27(18-7-9-19(10-8-18)30(37)39-6)29-23(15-32(3,4)17-25(29)36)34(22)20-11-12-26(38-5)21(33)13-20/h7-13,27H,14-17H2,1-6H3 |
| InChIKey | GQJBQFJVEYEOBU-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.08 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |