C29H33NO2S — CID 6621033
10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-9-thiophen-2-yl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 6621033) has the molecular formula C29H33NO2S and a molecular weight of 459.66 g/mol. Its IUPAC name is 10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-9-thiophen-2-yl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-9-thiophen-2-yl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 6621033 |
| Molecular Formula | C29H33NO2S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-9-thiophen-2-yl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | Cc1ccc(N2C3=C(C(=O)CC(C)(C)C3)C(c3cccs3)C3=C2CC(C)(C)CC3=O)cc1C |
| InChI | InChI=1S/C29H33NO2S/c1-17-9-10-19(12-18(17)2)30-20-13-28(3,4)15-22(31)25(20)27(24-8-7-11-33-24)26-21(30)14-29(5,6)16-23(26)32/h7-12,27H,13-16H2,1-6H3 |
| InChIKey | AZOIESXSBNNFHE-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |