C28H28N6O2S3 — CID 23829730
2-[[5-(2-amino-3-cyano-7,7-dimethyl-5-oxo-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-1-yl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 23829730) has the molecular formula C28H28N6O2S3 and a molecular weight of 576.77 g/mol. Its IUPAC name is 2-[[5-(2-amino-3-cyano-7,7-dimethyl-5-oxo-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-1-yl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[[5-(2-amino-3-cyano-7,7-dimethyl-5-oxo-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-1-yl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 23829730 |
| Molecular Formula | C28H28N6O2S3 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 2-[[5-(2-amino-3-cyano-7,7-dimethyl-5-oxo-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-1-yl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(N3C(N)=C(C#N)C(c4cccs4)C4=C3CC(C)(C)CC4=O)s2)cc1C |
| InChI | InChI=1S/C28H28N6O2S3/c1-15-7-8-17(10-16(15)2)31-22(36)14-38-27-33-32-26(39-27)34-19-11-28(3,4)12-20(35)24(19)23(18(13-29)25(34)30)21-6-5-9-37-21/h5-10,23H,11-12,14,30H2,1-4H3,(H,31,36) |
| InChIKey | RWKNUUYMSIQAQG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |