C27H24N6O4S3 — CID 23913930
2-[[5-(2-amino-3-cyano-7,7-dimethyl-5-oxo-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-1-yl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,3-benzodioxol-5-yl)acetamide (PubChem CID 23913930) has the molecular formula C27H24N6O4S3 and a molecular weight of 592.73 g/mol. Its IUPAC name is 2-[[5-(2-amino-3-cyano-7,7-dimethyl-5-oxo-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-1-yl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-[[5-(2-amino-3-cyano-7,7-dimethyl-5-oxo-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-1-yl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 23913930 |
| Molecular Formula | C27H24N6O4S3 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | 2-[[5-(2-amino-3-cyano-7,7-dimethyl-5-oxo-4-thiophen-2-yl-6,8-dihydro-4H-quinolin-1-yl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,3-benzodioxol-5-yl)acetamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1nnc(SCC(=O)Nc3ccc4c(c3)OCO4)s1)C(N)=C(C#N)C2c1cccs1 |
| InChI | InChI=1S/C27H24N6O4S3/c1-27(2)9-16-23(17(34)10-27)22(20-4-3-7-38-20)15(11-28)24(29)33(16)25-31-32-26(40-25)39-12-21(35)30-14-5-6-18-19(8-14)37-13-36-18/h3-8,22H,9-10,12-13,29H2,1-2H3,(H,30,35) |
| InChIKey | IWLGDDCUIWGUBN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |