C31H32N6O5S2 — CID 23858167
2-[[5-[2-amino-3-cyano-7,7-dimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide (PubChem CID 23858167) has the molecular formula C31H32N6O5S2 and a molecular weight of 632.77 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-7,7-dimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-7,7-dimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 23858167 |
| Molecular Formula | C31H32N6O5S2 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-7,7-dimethyl-5-oxo-4-(2,4,5-trimethoxyphenyl)-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide |
| SMILES | COc1cc(OC)c(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4ccccc4)s3)C3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C31H32N6O5S2/c1-31(2)13-20-27(21(38)14-31)26(18-11-23(41-4)24(42-5)12-22(18)40-3)19(15-32)28(33)37(20)29-35-36-30(44-29)43-16-25(39)34-17-9-7-6-8-10-17/h6-12,26H,13-14,16,33H2,1-5H3,(H,34,39) |
| InChIKey | UOWOULVLMCMFBO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 152.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |