C30H29ClN6O4S2 — CID 23742701
2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide (PubChem CID 23742701) has the molecular formula C30H29ClN6O4S2 and a molecular weight of 637.19 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 23742701 |
| Molecular Formula | C30H29ClN6O4S2 |
| Molecular Weight | 637.19 g/mol |
| Exact Mass | 636.14 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
| SMILES | COc1ccc(OC)c(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4cccc(Cl)c4)s3)C3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C30H29ClN6O4S2/c1-30(2)12-21-26(22(38)13-30)25(19-11-18(40-3)8-9-23(19)41-4)20(14-32)27(33)37(21)28-35-36-29(43-28)42-15-24(39)34-17-7-5-6-16(31)10-17/h5-11,25H,12-13,15,33H2,1-4H3,(H,34,39) |
| InChIKey | QVEURBVUTUKFGW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.19 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |