C28H25ClN6O4S2 — CID 23885877
2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide (PubChem CID 23885877) has the molecular formula C28H25ClN6O4S2 and a molecular weight of 609.13 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 23885877 |
| Molecular Formula | C28H25ClN6O4S2 |
| Molecular Weight | 609.13 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
| SMILES | COc1ccc(OC)c(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4cccc(Cl)c4)s3)C3=C2C(=O)CCC3)c1 |
| InChI | InChI=1S/C28H25ClN6O4S2/c1-38-17-9-10-22(39-2)18(12-17)24-19(13-30)26(31)35(20-7-4-8-21(36)25(20)24)27-33-34-28(41-27)40-14-23(37)32-16-6-3-5-15(29)11-16/h3,5-6,9-12,24H,4,7-8,14,31H2,1-2H3,(H,32,37) |
| InChIKey | YVTGVZLHOXIXLV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.13 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |