C28H26N6O4S2 — CID 23885783
2-[[5-[2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide (PubChem CID 23885783) has the molecular formula C28H26N6O4S2 and a molecular weight of 574.69 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 23885783 |
| Molecular Formula | C28H26N6O4S2 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-phenylacetamide |
| SMILES | COc1ccc(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4ccccc4)s3)C3=C2C(=O)CCC3)c(OC)c1 |
| InChI | InChI=1S/C28H26N6O4S2/c1-37-17-11-12-18(22(13-17)38-2)24-19(14-29)26(30)34(20-9-6-10-21(35)25(20)24)27-32-33-28(40-27)39-15-23(36)31-16-7-4-3-5-8-16/h3-5,7-8,11-13,24H,6,9-10,15,30H2,1-2H3,(H,31,36) |
| InChIKey | TXMPYIGUEUIQJZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |