C30H30N6O4S2 — CID 23913948
2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 23913948) has the molecular formula C30H30N6O4S2 and a molecular weight of 602.74 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 23913948 |
| Molecular Formula | C30H30N6O4S2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(2,5-dimethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | COc1ccc(OC)c(C2C(C#N)=C(N)N(c3nnc(SCC(=O)Nc4c(C)cccc4C)s3)C3=C2C(=O)CCC3)c1 |
| InChI | InChI=1S/C30H30N6O4S2/c1-16-7-5-8-17(2)27(16)33-24(38)15-41-30-35-34-29(42-30)36-21-9-6-10-22(37)26(21)25(20(14-31)28(36)32)19-13-18(39-3)11-12-23(19)40-4/h5,7-8,11-13,25H,6,9-10,15,32H2,1-4H3,(H,33,38) |
| InChIKey | LRVBCIYYDOFVSR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |