C28H24Cl2N6O2S2 — CID 23997635
2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 23997635) has the molecular formula C28H24Cl2N6O2S2 and a molecular weight of 611.58 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 23997635 |
| Molecular Formula | C28H24Cl2N6O2S2 |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CSc1nnc(N2C(N)=C(C#N)C(c3c(Cl)cccc3Cl)C3=C2CCCC3=O)s1 |
| InChI | InChI=1S/C28H24Cl2N6O2S2/c1-14-6-3-7-15(2)25(14)33-21(38)13-39-28-35-34-27(40-28)36-19-10-5-11-20(37)24(19)22(16(12-31)26(36)32)23-17(29)8-4-9-18(23)30/h3-4,6-9,22H,5,10-11,13,32H2,1-2H3,(H,33,38) |
| InChIKey | XGCAVJRGXKMALQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |