C27H21Cl2N7O3S2 — CID 23742676
2-[[2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzamide (PubChem CID 23742676) has the molecular formula C27H21Cl2N7O3S2 and a molecular weight of 626.55 g/mol. Its IUPAC name is 2-[[2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 23742676 |
| Molecular Formula | C27H21Cl2N7O3S2 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 625.05 |
| IUPAC Name | 2-[[2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-5-oxo-4,6,7,8-tetrahydroquinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzamide |
| SMILES | N#CC1=C(N)N(c2nnc(SCC(=O)Nc3ccccc3C(N)=O)s2)C2=C(C(=O)CCC2)C1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H21Cl2N7O3S2/c28-15-6-3-7-16(29)22(15)21-14(11-30)24(31)36(18-9-4-10-19(37)23(18)21)26-34-35-27(41-26)40-12-20(38)33-17-8-2-1-5-13(17)25(32)39/h1-3,5-8,21H,4,9-10,12,31H2,(H2,32,39)(H,33,38) |
| InChIKey | MRVBWNHMGBHGSF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 168.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |