C28H23Cl2FN6O2S2 — CID 23771839
2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-fluorophenyl)acetamide (PubChem CID 23771839) has the molecular formula C28H23Cl2FN6O2S2 and a molecular weight of 629.57 g/mol. Its IUPAC name is 2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 23771839 |
| Molecular Formula | C28H23Cl2FN6O2S2 |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 628.07 |
| IUPAC Name | 2-[[5-[2-amino-3-cyano-4-(2,6-dichlorophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinolin-1-yl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-fluorophenyl)acetamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1nnc(SCC(=O)Nc3ccccc3F)s1)C(N)=C(C#N)C2c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C28H23Cl2FN6O2S2/c1-28(2)10-19-24(20(38)11-28)22(23-15(29)6-5-7-16(23)30)14(12-32)25(33)37(19)26-35-36-27(41-26)40-13-21(39)34-18-9-4-3-8-17(18)31/h3-9,22H,10-11,13,33H2,1-2H3,(H,34,39) |
| InChIKey | ZUPXGECVTIVOEA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |